C30H42O6S — CID 11763173
methyl (3E,7E)-2-[(E)-4-acetyloxy-2-methylbut-2-enyl]-2-(benzenesulfonyl)-4,8,12-trimethyltrideca-3,7,11-trienoate (PubChem CID 11763173) has the molecular formula C30H42O6S and a molecular weight of 530.73 g/mol. Its IUPAC name is methyl (3E,7E)-2-[(E)-4-acetyloxy-2-methylbut-2-enyl]-2-(benzenesulfonyl)-4,8,12-trimethyltrideca-3,7,11-trienoate.
| Compound Name | methyl (3E,7E)-2-[(E)-4-acetyloxy-2-methylbut-2-enyl]-2-(benzenesulfonyl)-4,8,12-trimethyltrideca-3,7,11-trienoate |
|---|---|
| PubChem CID | 11763173 |
| Molecular Formula | C30H42O6S |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | methyl (3E,7E)-2-[(E)-4-acetyloxy-2-methylbut-2-enyl]-2-(benzenesulfonyl)-4,8,12-trimethyltrideca-3,7,11-trienoate |
| SMILES | COC(=O)C(/C=C(\C)CC/C=C(\C)CCC=C(C)C)(C/C(C)=C/COC(C)=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H42O6S/c1-23(2)13-11-14-24(3)15-12-16-25(4)21-30(29(32)35-7,22-26(5)19-20-36-27(6)31)37(33,34)28-17-9-8-10-18-28/h8-10,13,15,17-19,21H,11-12,14,16,20,22H2,1-7H3/b24-15+,25-21+,26-19+ |
| InChIKey | MGRPKMAKNJMPSS-DWONXFQBSA-N |
| XLogP | 6.69 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|