C31H33FN4O9 — CID 11763516
(4-fluorophenyl) N-[[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]carbamate (PubChem CID 11763516) has the molecular formula C31H33FN4O9 and a molecular weight of 624.62 g/mol. Its IUPAC name is (4-fluorophenyl) N-[[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]carbamate.
| Compound Name | (4-fluorophenyl) N-[[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 11763516 |
| Molecular Formula | C31H33FN4O9 |
| Molecular Weight | 624.62 g/mol |
| Exact Mass | 624.22 |
| IUPAC Name | (4-fluorophenyl) N-[[(5aR,6aS,7S,10aS)-9-carbamoyl-4,7-bis(dimethylamino)-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]carbamate |
| SMILES | CN(C)c1cc(CNC(=O)Oc2ccc(F)cc2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C31H33FN4O9/c1-35(2)19-11-14(12-34-30(43)45-16-7-5-15(32)6-8-16)24(37)21-17(19)9-13-10-18-23(36(3)4)26(39)22(29(33)42)28(41)31(18,44)27(40)20(13)25(21)38/h5-8,11,13,18,20,22-23,37,44H,9-10,12H2,1-4H3,(H2,33,42)(H,34,43)/t13-,18-,20?,22?,23-,31-/m0/s1 |
| InChIKey | WQHDJNBAVZXVFQ-SJOHOYINSA-N |
| XLogP | 0.36 |
| TPSA | 196.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.62 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|