C46H51NO8 — CID 11764105
(2R,3S,4R)-4-phenylmethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-amine (PubChem CID 11764105) has the molecular formula C46H51NO8 and a molecular weight of 745.91 g/mol. Its IUPAC name is (2R,3S,4R)-4-phenylmethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-amine.
| Compound Name | (2R,3S,4R)-4-phenylmethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-amine |
|---|---|
| PubChem CID | 11764105 |
| Molecular Formula | C46H51NO8 |
| Molecular Weight | 745.91 g/mol |
| Exact Mass | 745.36 |
| IUPAC Name | (2R,3S,4R)-4-phenylmethoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxyoxan-2-amine |
| SMILES | N[C@@H]1OCC[C@@H](OCc2ccccc2)[C@@H]1O[C@@H]1O[C@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C46H51NO8/c47-45-42(39(26-27-49-45)50-29-35-18-8-2-9-19-35)55-46-44(53-32-38-24-14-5-15-25-38)43(52-31-37-22-12-4-13-23-37)41(51-30-36-20-10-3-11-21-36)40(54-46)33-48-28-34-16-6-1-7-17-34/h1-25,39-46H,26-33,47H2/t39-,40-,41+,42+,43+,44-,45-,46+/m1/s1 |
| InChIKey | OLRDHXQWXLIBMH-CYDXYGTRSA-N |
| XLogP | 7.36 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.91 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |