C28H30N2O12 — CID 11767085
2-[(3,4-diacetyloxybenzoyl)-[4-[(3,4-diacetyloxybenzoyl)amino]butyl]amino]acetic acid (PubChem CID 11767085) has the molecular formula C28H30N2O12 and a molecular weight of 586.55 g/mol. Its IUPAC name is 2-[(3,4-diacetyloxybenzoyl)-[4-[(3,4-diacetyloxybenzoyl)amino]butyl]amino]acetic acid.
| Compound Name | 2-[(3,4-diacetyloxybenzoyl)-[4-[(3,4-diacetyloxybenzoyl)amino]butyl]amino]acetic acid |
|---|---|
| PubChem CID | 11767085 |
| Molecular Formula | C28H30N2O12 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 2-[(3,4-diacetyloxybenzoyl)-[4-[(3,4-diacetyloxybenzoyl)amino]butyl]amino]acetic acid |
| SMILES | CC(=O)Oc1ccc(C(=O)NCCCCN(CC(=O)O)C(=O)c2ccc(OC(C)=O)c(OC(C)=O)c2)cc1OC(C)=O |
| InChI | InChI=1S/C28H30N2O12/c1-16(31)39-22-9-7-20(13-24(22)41-18(3)33)27(37)29-11-5-6-12-30(15-26(35)36)28(38)21-8-10-23(40-17(2)32)25(14-21)42-19(4)34/h7-10,13-14H,5-6,11-12,15H2,1-4H3,(H,29,37)(H,35,36) |
| InChIKey | XHGFMMXJGZFPNY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 191.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|