C28H31N3O11 — CID 122661712
[2-acetyloxy-3-[4-[(2-amino-2-oxoethyl)-(2,3-diacetyloxybenzoyl)amino]butylcarbamoyl]phenyl] acetate (PubChem CID 122661712) has the molecular formula C28H31N3O11 and a molecular weight of 585.57 g/mol. Its IUPAC name is [2-acetyloxy-3-[4-[(2-amino-2-oxoethyl)-(2,3-diacetyloxybenzoyl)amino]butylcarbamoyl]phenyl] acetate.
| Compound Name | [2-acetyloxy-3-[4-[(2-amino-2-oxoethyl)-(2,3-diacetyloxybenzoyl)amino]butylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 122661712 |
| Molecular Formula | C28H31N3O11 |
| Molecular Weight | 585.57 g/mol |
| Exact Mass | 585.20 |
| IUPAC Name | [2-acetyloxy-3-[4-[(2-amino-2-oxoethyl)-(2,3-diacetyloxybenzoyl)amino]butylcarbamoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCCCN(CC(N)=O)C(=O)c2cccc(OC(C)=O)c2OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C28H31N3O11/c1-16(32)39-22-11-7-9-20(25(22)41-18(3)34)27(37)30-13-5-6-14-31(15-24(29)36)28(38)21-10-8-12-23(40-17(2)33)26(21)42-19(4)35/h7-12H,5-6,13-15H2,1-4H3,(H2,29,36)(H,30,37) |
| InChIKey | OQOPPDQQMOJASP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 197.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.57 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|