C16H22N2O6 — CID 146263738
[2-acetyloxy-3-(1-aminooxypentylcarbamoyl)phenyl] acetate (PubChem CID 146263738) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is [2-acetyloxy-3-(1-aminooxypentylcarbamoyl)phenyl] acetate.
| Compound Name | [2-acetyloxy-3-(1-aminooxypentylcarbamoyl)phenyl] acetate |
|---|---|
| PubChem CID | 146263738 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [2-acetyloxy-3-(1-aminooxypentylcarbamoyl)phenyl] acetate |
| SMILES | CCCCC(NC(=O)c1cccc(OC(C)=O)c1OC(C)=O)ON |
| InChI | InChI=1S/C16H22N2O6/c1-4-5-9-14(24-17)18-16(21)12-7-6-8-13(22-10(2)19)15(12)23-11(3)20/h6-8,14H,4-5,9,17H2,1-3H3,(H,18,21) |
| InChIKey | SYKUOOYTPCBCKK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|