About [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate
[2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate (PubChem CID 54432476) has the molecular formula C28H24O8
and a molecular weight of 488.49 g/mol. Its IUPAC name is [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate.
Molecular Properties
| Compound Name | [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate |
| PubChem CID | 54432476 |
| Molecular Formula | C28H24O8 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=Cc2ccccc2)c2cccc(OC(C)=O)c2OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C28H24O8/c1-17(29)33-25-14-8-12-22(27(25)35-19(3)31)24(16-21-10-6-5-7-11-21)23-13-9-15-26(34-18(2)30)28(23)36-20(4)32/h5-16H,1-4H3 |
| InChIKey | WILCDZQLRAUHPM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate?
The IUPAC name of [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate (CID 54432476) is [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate.
What is the SMILES notation for [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate?
The canonical SMILES for [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate is CC(=O)Oc1cccc(C(=Cc2ccccc2)c2cccc(OC(C)=O)c2OC(C)=O)c1OC(C)=O.
What is the InChIKey of [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate?
The InChIKey is WILCDZQLRAUHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24O8/c1-17(29)33-25-14-8-12-22(27(25)35-19(3)31)24(16-21-10-6-5-7-11-21)23-13-9-15-26(34-18(2)30)28(23)36-20(4)32/h5-16H,1-4H3.
What are the key properties of [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate?
[2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate has a molecular weight of 488.49 g/mol, XLogP of 4.98, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-acetyloxy-3-[1-(2,3-diacetyloxyphenyl)-2-phenylethenyl]phenyl] acetate is sourced from PubChem (CID 54432476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).