C15H20N2O6 — CID 90789030
2-acetyloxy-3-[(2S)-2,6-diaminohexanoyl]oxybenzoic acid (PubChem CID 90789030) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-acetyloxy-3-[(2S)-2,6-diaminohexanoyl]oxybenzoic acid.
| Compound Name | 2-acetyloxy-3-[(2S)-2,6-diaminohexanoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 90789030 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-acetyloxy-3-[(2S)-2,6-diaminohexanoyl]oxybenzoic acid |
| SMILES | CC(=O)Oc1c(OC(=O)[C@@H](N)CCCCN)cccc1C(=O)O |
| InChI | InChI=1S/C15H20N2O6/c1-9(18)22-13-10(14(19)20)5-4-7-12(13)23-15(21)11(17)6-2-3-8-16/h4-5,7,11H,2-3,6,8,16-17H2,1H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | LKOUAYVLMYCOAY-NSHDSACASA-N |
| XLogP | 0.67 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|