C21H28N2O8 — CID 146263579
tert-butyl 6-[(2,3-diacetyloxybenzoyl)amino]-2-nitrosohexanoate (PubChem CID 146263579) has the molecular formula C21H28N2O8 and a molecular weight of 436.46 g/mol. Its IUPAC name is tert-butyl 6-[(2,3-diacetyloxybenzoyl)amino]-2-nitrosohexanoate.
| Compound Name | tert-butyl 6-[(2,3-diacetyloxybenzoyl)amino]-2-nitrosohexanoate |
|---|---|
| PubChem CID | 146263579 |
| Molecular Formula | C21H28N2O8 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | tert-butyl 6-[(2,3-diacetyloxybenzoyl)amino]-2-nitrosohexanoate |
| SMILES | CC(=O)Oc1cccc(C(=O)NCCCCC(N=O)C(=O)OC(C)(C)C)c1OC(C)=O |
| InChI | InChI=1S/C21H28N2O8/c1-13(24)29-17-11-8-9-15(18(17)30-14(2)25)19(26)22-12-7-6-10-16(23-28)20(27)31-21(3,4)5/h8-9,11,16H,6-7,10,12H2,1-5H3,(H,22,26) |
| InChIKey | AHQRLAVINKGSGX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|