C13H20O3 — CID 11770104
(1aR,3R,3aR,7aR,7bS)-7b-methyl-3-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1aH-oxireno[2,3-f]isochromen-6-one (PubChem CID 11770104) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (1aR,3R,3aR,7aR,7bS)-7b-methyl-3-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1aH-oxireno[2,3-f]isochromen-6-one.
| Compound Name | (1aR,3R,3aR,7aR,7bS)-7b-methyl-3-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1aH-oxireno[2,3-f]isochromen-6-one |
|---|---|
| PubChem CID | 11770104 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (1aR,3R,3aR,7aR,7bS)-7b-methyl-3-propan-2-yl-2,3,3a,4,7,7a-hexahydro-1aH-oxireno[2,3-f]isochromen-6-one |
| SMILES | CC(C)[C@H]1C[C@H]2O[C@@]2(C)[C@@H]2CC(=O)OC[C@H]12 |
| InChI | InChI=1S/C13H20O3/c1-7(2)8-4-11-13(3,16-11)10-5-12(14)15-6-9(8)10/h7-11H,4-6H2,1-3H3/t8-,9-,10-,11-,13+/m1/s1 |
| InChIKey | BLKFGKXVKSSORC-CJJWORHMSA-N |
| XLogP | 2.00 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|