C17H24O2 — CID 21049847
4,5-dimethyl-11-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadecan-12-one (PubChem CID 21049847) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4,5-dimethyl-11-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadecan-12-one.
| Compound Name | 4,5-dimethyl-11-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadecan-12-one |
|---|---|
| PubChem CID | 21049847 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 4,5-dimethyl-11-oxapentacyclo[6.6.1.13,6.02,7.09,14]hexadecan-12-one |
| SMILES | CC1C(C)C2CC1C1C3CC(C4CC(=O)OCC43)C21 |
| InChI | InChI=1S/C17H24O2/c1-7-8(2)10-3-9(7)16-12-4-13(17(10)16)14-6-19-15(18)5-11(12)14/h7-14,16-17H,3-6H2,1-2H3 |
| InChIKey | NBJRRTKKXMXHRC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|