C15H20O2S — CID 146326876
5-methyl-4-sulfanyl-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-10-one (PubChem CID 146326876) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 5-methyl-4-sulfanyl-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-10-one.
| Compound Name | 5-methyl-4-sulfanyl-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-10-one |
|---|---|
| PubChem CID | 146326876 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 5-methyl-4-sulfanyl-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-10-one |
| SMILES | CC1C(S)C2CC1C1C3CC(C4COC(=O)C43)C21 |
| InChI | InChI=1S/C15H20O2S/c1-5-6-2-9(14(5)18)12-7-3-8(11(6)12)13-10(7)4-17-15(13)16/h5-14,18H,2-4H2,1H3 |
| InChIKey | OEQQQCLQDSSPRO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|