C29H38O4 — CID 160529368
4,5-dimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione;8,9-dimethyltricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 160529368) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 4,5-dimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione;8,9-dimethyltricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4,5-dimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione;8,9-dimethyltricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 160529368 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 4,5-dimethylpentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione;8,9-dimethyltricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC1C(C)C2CC1C1C(=O)CC(=O)C21.CC1C(C)C2CC1C1C3CC(C4C(=O)CC(=O)C34)C21 |
| InChI | InChI=1S/C17H22O2.C12H16O2/c1-6-7(2)9-3-8(6)14-10-4-11(15(9)14)17-13(19)5-12(18)16(10)17;1-5-6(2)8-3-7(5)11-9(13)4-10(14)12(8)11/h6-11,14-17H,3-5H2,1-2H3;5-8,11-12H,3-4H2,1-2H3 |
| InChIKey | QVIGOHYAJLYCGO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|