C12H18O4 — CID 11770155
tert-butyl (E)-3,5-dioxooct-6-enoate (PubChem CID 11770155) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is tert-butyl (E)-3,5-dioxooct-6-enoate.
| Compound Name | tert-butyl (E)-3,5-dioxooct-6-enoate |
|---|---|
| PubChem CID | 11770155 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | tert-butyl (E)-3,5-dioxooct-6-enoate |
| SMILES | C/C=C/C(=O)CC(=O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H18O4/c1-5-6-9(13)7-10(14)8-11(15)16-12(2,3)4/h5-6H,7-8H2,1-4H3/b6-5+ |
| InChIKey | HSNBRUYPEUWQLH-AATRIKPKSA-N |
| XLogP | 1.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|