C16H24ClN3O2 — CID 11771739
4-[(3-chlorophenyl)carbamoylamino]-N-pentylbutanamide (PubChem CID 11771739) has the molecular formula C16H24ClN3O2 and a molecular weight of 325.84 g/mol. Its IUPAC name is 4-[(3-chlorophenyl)carbamoylamino]-N-pentylbutanamide.
| Compound Name | 4-[(3-chlorophenyl)carbamoylamino]-N-pentylbutanamide |
|---|---|
| PubChem CID | 11771739 |
| Molecular Formula | C16H24ClN3O2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 4-[(3-chlorophenyl)carbamoylamino]-N-pentylbutanamide |
| SMILES | CCCCCNC(=O)CCCNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H24ClN3O2/c1-2-3-4-10-18-15(21)9-6-11-19-16(22)20-14-8-5-7-13(17)12-14/h5,7-8,12H,2-4,6,9-11H2,1H3,(H,18,21)(H2,19,20,22) |
| InChIKey | GUDSECAQNJNHGI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|