About 3-(3-chlorophenyl)-1,1-diethylurea
3-(3-chlorophenyl)-1,1-diethylurea (PubChem CID 567779) has the molecular formula C11H15ClN2O
and a molecular weight of 226.71 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-(3-chlorophenyl)-1,1-diethylurea |
| PubChem CID | 567779 |
| Molecular Formula | C11H15ClN2O |
| Molecular Weight | 226.71 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-(3-chlorophenyl)-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H15ClN2O/c1-3-14(4-2)11(15)13-10-7-5-6-9(12)8-10/h5-8H,3-4H2,1-2H3,(H,13,15) |
| InChIKey | FXODCODKNPOVAX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.71 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3-chlorophenyl)-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorophenyl)-1,1-diethylurea?
The IUPAC name of 3-(3-chlorophenyl)-1,1-diethylurea (CID 567779) is 3-(3-chlorophenyl)-1,1-diethylurea.
What is the SMILES notation for 3-(3-chlorophenyl)-1,1-diethylurea?
The canonical SMILES for 3-(3-chlorophenyl)-1,1-diethylurea is CCN(CC)C(=O)Nc1cccc(Cl)c1.
What is the InChIKey of 3-(3-chlorophenyl)-1,1-diethylurea?
The InChIKey is FXODCODKNPOVAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O/c1-3-14(4-2)11(15)13-10-7-5-6-9(12)8-10/h5-8H,3-4H2,1-2H3,(H,13,15).
What are the key properties of 3-(3-chlorophenyl)-1,1-diethylurea?
3-(3-chlorophenyl)-1,1-diethylurea has a molecular weight of 226.71 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorophenyl)-1,1-diethylurea is sourced from PubChem (CID 567779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).