C18H22N4O4 — CID 11772735
[2-(methylamino)-2-oxoethyl] 4-hydroxy-4-(4-phenylimidazol-1-yl)piperidine-1-carboxylate (PubChem CID 11772735) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-hydroxy-4-(4-phenylimidazol-1-yl)piperidine-1-carboxylate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-hydroxy-4-(4-phenylimidazol-1-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11772735 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-hydroxy-4-(4-phenylimidazol-1-yl)piperidine-1-carboxylate |
| SMILES | CNC(=O)COC(=O)N1CCC(O)(n2cnc(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C18H22N4O4/c1-19-16(23)12-26-17(24)21-9-7-18(25,8-10-21)22-11-15(20-13-22)14-5-3-2-4-6-14/h2-6,11,13,25H,7-10,12H2,1H3,(H,19,23) |
| InChIKey | IEJYFQIOTLJYRP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |