C25H36O4 — CID 11773977
2,2-dimethylpropyl 2-[(8S,9S,11R,13S,14S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]acetate (PubChem CID 11773977) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2,2-dimethylpropyl 2-[(8S,9S,11R,13S,14S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]acetate.
| Compound Name | 2,2-dimethylpropyl 2-[(8S,9S,11R,13S,14S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]acetate |
|---|---|
| PubChem CID | 11773977 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2,2-dimethylpropyl 2-[(8S,9S,11R,13S,14S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-11-yl]acetate |
| SMILES | CC(C)(C)COC(=O)C[C@H]1C[C@]2(C)C(O)CC[C@H]2[C@@H]2CCc3cc(O)ccc3[C@@H]12 |
| InChI | InChI=1S/C25H36O4/c1-24(2,3)14-29-22(28)12-16-13-25(4)20(9-10-21(25)27)19-7-5-15-11-17(26)6-8-18(15)23(16)19/h6,8,11,16,19-21,23,26-27H,5,7,9-10,12-14H2,1-4H3/t16-,19-,20-,21?,23+,25-/m0/s1 |
| InChIKey | PXRRMCXNWHQHJW-XPAKHAPNSA-N |
| XLogP | 4.81 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |