C21H22O8 — CID 11774004
methyl 3-[1-(2,6-dihydroxy-3-methoxycarbonylphenyl)-3-methylbut-2-enyl]-2,4-dihydroxybenzoate (PubChem CID 11774004) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is methyl 3-[1-(2,6-dihydroxy-3-methoxycarbonylphenyl)-3-methylbut-2-enyl]-2,4-dihydroxybenzoate.
| Compound Name | methyl 3-[1-(2,6-dihydroxy-3-methoxycarbonylphenyl)-3-methylbut-2-enyl]-2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 11774004 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | methyl 3-[1-(2,6-dihydroxy-3-methoxycarbonylphenyl)-3-methylbut-2-enyl]-2,4-dihydroxybenzoate |
| SMILES | COC(=O)c1ccc(O)c(C(C=C(C)C)c2c(O)ccc(C(=O)OC)c2O)c1O |
| InChI | InChI=1S/C21H22O8/c1-10(2)9-13(16-14(22)7-5-11(18(16)24)20(26)28-3)17-15(23)8-6-12(19(17)25)21(27)29-4/h5-9,13,22-25H,1-4H3 |
| InChIKey | WIRMYFQWOFCOPL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|