C21H26N4O3S — CID 11774332
2-methyl-5-(methylsulfamoyl)-N-(4-pyrrolidin-1-ylphenyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 11774332) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-methyl-5-(methylsulfamoyl)-N-(4-pyrrolidin-1-ylphenyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | 2-methyl-5-(methylsulfamoyl)-N-(4-pyrrolidin-1-ylphenyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 11774332 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-methyl-5-(methylsulfamoyl)-N-(4-pyrrolidin-1-ylphenyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc2c(c1)CC(C)N2C(=O)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C21H26N4O3S/c1-15-13-16-14-19(29(27,28)22-2)9-10-20(16)25(15)21(26)23-17-5-7-18(8-6-17)24-11-3-4-12-24/h5-10,14-15,22H,3-4,11-13H2,1-2H3,(H,23,26) |
| InChIKey | OYZXWIRWCSLBFB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|