C27H30N4O4S — CID 142032448
6-(benzylsulfamoyl)-2-methyl-N-(4-morpholin-4-ylphenyl)-2,3-dihydroindole-1-carboxamide (PubChem CID 142032448) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is 6-(benzylsulfamoyl)-2-methyl-N-(4-morpholin-4-ylphenyl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | 6-(benzylsulfamoyl)-2-methyl-N-(4-morpholin-4-ylphenyl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 142032448 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 6-(benzylsulfamoyl)-2-methyl-N-(4-morpholin-4-ylphenyl)-2,3-dihydroindole-1-carboxamide |
| SMILES | CC1Cc2ccc(S(=O)(=O)NCc3ccccc3)cc2N1C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C27H30N4O4S/c1-20-17-22-7-12-25(36(33,34)28-19-21-5-3-2-4-6-21)18-26(22)31(20)27(32)29-23-8-10-24(11-9-23)30-13-15-35-16-14-30/h2-12,18,20,28H,13-17,19H2,1H3,(H,29,32) |
| InChIKey | IYBZRCKXYGOOEZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|