C15H13NO3 — CID 11780088
1-methyl-3-(4-oxo-2,3-dihydropyran-2-yl)quinolin-2-one (PubChem CID 11780088) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 1-methyl-3-(4-oxo-2,3-dihydropyran-2-yl)quinolin-2-one.
| Compound Name | 1-methyl-3-(4-oxo-2,3-dihydropyran-2-yl)quinolin-2-one |
|---|---|
| PubChem CID | 11780088 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-methyl-3-(4-oxo-2,3-dihydropyran-2-yl)quinolin-2-one |
| SMILES | Cn1c(=O)c(C2CC(=O)C=CO2)cc2ccccc21 |
| InChI | InChI=1S/C15H13NO3/c1-16-13-5-3-2-4-10(13)8-12(15(16)18)14-9-11(17)6-7-19-14/h2-8,14H,9H2,1H3 |
| InChIKey | KDOYZABTPGBETJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |