C15H19NO5S — CID 11782329
ethyl (E)-4-[benzenesulfonyl(3-oxopropyl)amino]but-2-enoate (PubChem CID 11782329) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is ethyl (E)-4-[benzenesulfonyl(3-oxopropyl)amino]but-2-enoate.
| Compound Name | ethyl (E)-4-[benzenesulfonyl(3-oxopropyl)amino]but-2-enoate |
|---|---|
| PubChem CID | 11782329 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | ethyl (E)-4-[benzenesulfonyl(3-oxopropyl)amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN(CCC=O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H19NO5S/c1-2-21-15(18)10-6-11-16(12-7-13-17)22(19,20)14-8-4-3-5-9-14/h3-6,8-10,13H,2,7,11-12H2,1H3/b10-6+ |
| InChIKey | JYRDPBOFIIMGII-UXBLZVDNSA-N |
| XLogP | 1.39 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|