C19H20O6S — CID 11783723
(6R)-4-(benzenesulfonyl)-6-[(1R,2S)-1,2-dihydroxy-2-phenylethyl]oxan-2-one (PubChem CID 11783723) has the molecular formula C19H20O6S and a molecular weight of 376.43 g/mol. Its IUPAC name is (6R)-4-(benzenesulfonyl)-6-[(1R,2S)-1,2-dihydroxy-2-phenylethyl]oxan-2-one.
| Compound Name | (6R)-4-(benzenesulfonyl)-6-[(1R,2S)-1,2-dihydroxy-2-phenylethyl]oxan-2-one |
|---|---|
| PubChem CID | 11783723 |
| Molecular Formula | C19H20O6S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (6R)-4-(benzenesulfonyl)-6-[(1R,2S)-1,2-dihydroxy-2-phenylethyl]oxan-2-one |
| SMILES | O=C1CC(S(=O)(=O)c2ccccc2)C[C@H]([C@H](O)[C@@H](O)c2ccccc2)O1 |
| InChI | InChI=1S/C19H20O6S/c20-17-12-15(26(23,24)14-9-5-2-6-10-14)11-16(25-17)19(22)18(21)13-7-3-1-4-8-13/h1-10,15-16,18-19,21-22H,11-12H2/t15?,16-,18+,19+/m1/s1 |
| InChIKey | NXQRNIVNPAGCGB-ZXBAEOAUSA-N |
| XLogP | 1.63 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |