C17H18O5S — CID 134872548
methyl 3-(benzenesulfonyl)-4-hydroxy-4-phenylbutanoate (PubChem CID 134872548) has the molecular formula C17H18O5S and a molecular weight of 334.39 g/mol. Its IUPAC name is methyl 3-(benzenesulfonyl)-4-hydroxy-4-phenylbutanoate.
| Compound Name | methyl 3-(benzenesulfonyl)-4-hydroxy-4-phenylbutanoate |
|---|---|
| PubChem CID | 134872548 |
| Molecular Formula | C17H18O5S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | methyl 3-(benzenesulfonyl)-4-hydroxy-4-phenylbutanoate |
| SMILES | COC(=O)CC(C(O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18O5S/c1-22-16(18)12-15(17(19)13-8-4-2-5-9-13)23(20,21)14-10-6-3-7-11-14/h2-11,15,17,19H,12H2,1H3 |
| InChIKey | ZPSWWVZOXFPMTH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |