C17H18O6S — CID 102182708
[(1S,2R,3S)-1-(benzenesulfonyl)-2,3-dihydroxy-3-phenylpropyl] acetate (PubChem CID 102182708) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is [(1S,2R,3S)-1-(benzenesulfonyl)-2,3-dihydroxy-3-phenylpropyl] acetate.
| Compound Name | [(1S,2R,3S)-1-(benzenesulfonyl)-2,3-dihydroxy-3-phenylpropyl] acetate |
|---|---|
| PubChem CID | 102182708 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [(1S,2R,3S)-1-(benzenesulfonyl)-2,3-dihydroxy-3-phenylpropyl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](O)[C@@H](O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18O6S/c1-12(18)23-17(24(21,22)14-10-6-3-7-11-14)16(20)15(19)13-8-4-2-5-9-13/h2-11,15-17,19-20H,1H3/t15-,16+,17-/m0/s1 |
| InChIKey | MGMCBWMCVFJOHI-BBWFWOEESA-N |
| XLogP | 1.44 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |