C22H28O5S — CID 11784462
[(1R,2R,3S,5S)-5-hydroxy-2-methyl-3-(phenylmethoxymethyl)cyclopentyl]methyl 4-methylbenzenesulfonate (PubChem CID 11784462) has the molecular formula C22H28O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is [(1R,2R,3S,5S)-5-hydroxy-2-methyl-3-(phenylmethoxymethyl)cyclopentyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,3S,5S)-5-hydroxy-2-methyl-3-(phenylmethoxymethyl)cyclopentyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11784462 |
| Molecular Formula | C22H28O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [(1R,2R,3S,5S)-5-hydroxy-2-methyl-3-(phenylmethoxymethyl)cyclopentyl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2[C@H](C)[C@@H](COCc3ccccc3)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C22H28O5S/c1-16-8-10-20(11-9-16)28(24,25)27-15-21-17(2)19(12-22(21)23)14-26-13-18-6-4-3-5-7-18/h3-11,17,19,21-23H,12-15H2,1-2H3/t17-,19-,21+,22+/m1/s1 |
| InChIKey | WDBWYBRHNVLGSK-IVOMFYJKSA-N |
| XLogP | 3.55 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|