C20H24O5S — CID 12996906
[(1R,2R,3S)-2-hydroxy-3-methoxy-2-methyl-3-phenylcyclopentyl] 4-methylbenzenesulfonate (PubChem CID 12996906) has the molecular formula C20H24O5S and a molecular weight of 376.47 g/mol. Its IUPAC name is [(1R,2R,3S)-2-hydroxy-3-methoxy-2-methyl-3-phenylcyclopentyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,3S)-2-hydroxy-3-methoxy-2-methyl-3-phenylcyclopentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 12996906 |
| Molecular Formula | C20H24O5S |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | [(1R,2R,3S)-2-hydroxy-3-methoxy-2-methyl-3-phenylcyclopentyl] 4-methylbenzenesulfonate |
| SMILES | CO[C@]1(c2ccccc2)CC[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@]1(C)O |
| InChI | InChI=1S/C20H24O5S/c1-15-9-11-17(12-10-15)26(22,23)25-18-13-14-20(24-3,19(18,2)21)16-7-5-4-6-8-16/h4-12,18,21H,13-14H2,1-3H3/t18-,19-,20+/m1/s1 |
| InChIKey | MZTOJPUQBHJEQZ-AQNXPRMDSA-N |
| XLogP | 3.16 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|