C28H33NO6 — CID 11784899
(2R,3R,4R,5R)-1-hydroxy-3-(methoxymethoxy)-2-(4-methoxyphenyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)pyrrolidine (PubChem CID 11784899) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is (2R,3R,4R,5R)-1-hydroxy-3-(methoxymethoxy)-2-(4-methoxyphenyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)pyrrolidine.
| Compound Name | (2R,3R,4R,5R)-1-hydroxy-3-(methoxymethoxy)-2-(4-methoxyphenyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 11784899 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | (2R,3R,4R,5R)-1-hydroxy-3-(methoxymethoxy)-2-(4-methoxyphenyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)pyrrolidine |
| SMILES | COCO[C@H]1[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N(O)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H33NO6/c1-31-20-35-28-26(23-13-15-24(32-2)16-14-23)29(30)25(19-33-17-21-9-5-3-6-10-21)27(28)34-18-22-11-7-4-8-12-22/h3-16,25-28,30H,17-20H2,1-2H3/t25-,26-,27-,28-/m1/s1 |
| InChIKey | YOTJHVRQBWYUGA-BIYDSLDMSA-N |
| XLogP | 4.60 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|