C23H22ClN7O3 — CID 11784902
7-chloro-3-oxo-8-(pyridin-3-ylmethylamino)-11,17-dioxa-2,4,20,22-tetrazatricyclo[16.3.1.05,10]docosa-1(21),5,7,9,18(22),19-hexaene-19-carbonitrile (PubChem CID 11784902) has the molecular formula C23H22ClN7O3 and a molecular weight of 479.93 g/mol. Its IUPAC name is 7-chloro-3-oxo-8-(pyridin-3-ylmethylamino)-11,17-dioxa-2,4,20,22-tetrazatricyclo[16.3.1.05,10]docosa-1(21),5,7,9,18(22),19-hexaene-19-carbonitrile.
| Compound Name | 7-chloro-3-oxo-8-(pyridin-3-ylmethylamino)-11,17-dioxa-2,4,20,22-tetrazatricyclo[16.3.1.05,10]docosa-1(21),5,7,9,18(22),19-hexaene-19-carbonitrile |
|---|---|
| PubChem CID | 11784902 |
| Molecular Formula | C23H22ClN7O3 |
| Molecular Weight | 479.93 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 7-chloro-3-oxo-8-(pyridin-3-ylmethylamino)-11,17-dioxa-2,4,20,22-tetrazatricyclo[16.3.1.05,10]docosa-1(21),5,7,9,18(22),19-hexaene-19-carbonitrile |
| SMILES | N#Cc1ncc2nc1OCCCCCOc1cc(NCc3cccnc3)c(Cl)cc1NC(=O)N2 |
| InChI | InChI=1S/C23H22ClN7O3/c24-16-9-18-20(10-17(16)27-13-15-5-4-6-26-12-15)33-7-2-1-3-8-34-22-19(11-25)28-14-21(30-22)31-23(32)29-18/h4-6,9-10,12,14,27H,1-3,7-8,13H2,(H2,29,30,31,32) |
| InChIKey | KBIZEWFFKYHOLK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |