C26H27ClN8O6S — CID 11215676
N-(7-chloro-19-cyano-3-oxo-11,17-dioxa-2,4,20,22-tetrazatricyclo[16.3.1.05,10]docosa-1(21),5,7,9,18(22),19-hexaen-8-yl)-6-morpholin-4-ylpyridine-3-sulfonamide (PubChem CID 11215676) has the molecular formula C26H27ClN8O6S and a molecular weight of 615.07 g/mol. Its IUPAC name is N-(7-chloro-19-cyano-3-oxo-11,17-dioxa-2,4,20,22-tetrazatricyclo[16.3.1.05,10]docosa-1(21),5,7,9,18(22),19-hexaen-8-yl)-6-morpholin-4-ylpyridine-3-sulfonamide.
| Compound Name | N-(7-chloro-19-cyano-3-oxo-11,17-dioxa-2,4,20,22-tetrazatricyclo[16.3.1.05,10]docosa-1(21),5,7,9,18(22),19-hexaen-8-yl)-6-morpholin-4-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 11215676 |
| Molecular Formula | C26H27ClN8O6S |
| Molecular Weight | 615.07 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | N-(7-chloro-19-cyano-3-oxo-11,17-dioxa-2,4,20,22-tetrazatricyclo[16.3.1.05,10]docosa-1(21),5,7,9,18(22),19-hexaen-8-yl)-6-morpholin-4-ylpyridine-3-sulfonamide |
| SMILES | N#Cc1ncc2nc1OCCCCCOc1cc(NS(=O)(=O)c3ccc(N4CCOCC4)nc3)c(Cl)cc1NC(=O)N2 |
| InChI | InChI=1S/C26H27ClN8O6S/c27-18-12-20-22(13-19(18)34-42(37,38)17-4-5-24(30-15-17)35-6-10-39-11-7-35)40-8-2-1-3-9-41-25-21(14-28)29-16-23(32-25)33-26(36)31-20/h4-5,12-13,15-16,34H,1-3,6-11H2,(H2,31,32,33,36) |
| InChIKey | VNSKOEYXFZHHGA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 180.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.07 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |