C28H35N5O3 — CID 11785114
N-[6-(pentan-3-ylamino)pyrazin-2-yl]-2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanamide (PubChem CID 11785114) has the molecular formula C28H35N5O3 and a molecular weight of 489.62 g/mol. Its IUPAC name is N-[6-(pentan-3-ylamino)pyrazin-2-yl]-2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanamide.
| Compound Name | N-[6-(pentan-3-ylamino)pyrazin-2-yl]-2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 11785114 |
| Molecular Formula | C28H35N5O3 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | N-[6-(pentan-3-ylamino)pyrazin-2-yl]-2-[[2-(3-phenoxyphenyl)acetyl]amino]pentanamide |
| SMILES | CCCC(NC(=O)Cc1cccc(Oc2ccccc2)c1)C(=O)Nc1cncc(NC(CC)CC)n1 |
| InChI | InChI=1S/C28H35N5O3/c1-4-11-24(28(35)33-26-19-29-18-25(32-26)30-21(5-2)6-3)31-27(34)17-20-12-10-15-23(16-20)36-22-13-8-7-9-14-22/h7-10,12-16,18-19,21,24H,4-6,11,17H2,1-3H3,(H,31,34)(H2,30,32,33,35) |
| InChIKey | RISAPKUCHQDINO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |