C33H50N6O5Si2 — CID 11787198
N-[4,6-dimethoxy-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-5-yl]-5-[(1,1,4,4,5,7-hexamethyl-2,3-dihydro-1,4-benzodisilin-6-yl)oxy]furan-2-carboxamide (PubChem CID 11787198) has the molecular formula C33H50N6O5Si2 and a molecular weight of 666.97 g/mol. Its IUPAC name is N-[4,6-dimethoxy-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-5-yl]-5-[(1,1,4,4,5,7-hexamethyl-2,3-dihydro-1,4-benzodisilin-6-yl)oxy]furan-2-carboxamide.
| Compound Name | N-[4,6-dimethoxy-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-5-yl]-5-[(1,1,4,4,5,7-hexamethyl-2,3-dihydro-1,4-benzodisilin-6-yl)oxy]furan-2-carboxamide |
|---|---|
| PubChem CID | 11787198 |
| Molecular Formula | C33H50N6O5Si2 |
| Molecular Weight | 666.97 g/mol |
| Exact Mass | 666.34 |
| IUPAC Name | N-[4,6-dimethoxy-2-[3-(4-methylpiperazin-1-yl)propylamino]pyrimidin-5-yl]-5-[(1,1,4,4,5,7-hexamethyl-2,3-dihydro-1,4-benzodisilin-6-yl)oxy]furan-2-carboxamide |
| SMILES | COc1nc(NCCCN2CCN(C)CC2)nc(OC)c1NC(=O)c1ccc(Oc2c(C)cc3c(c2C)[Si](C)(C)CC[Si]3(C)C)o1 |
| InChI | InChI=1S/C33H50N6O5Si2/c1-22-21-25-29(46(8,9)20-19-45(25,6)7)23(2)28(22)44-26-12-11-24(43-26)30(40)35-27-31(41-4)36-33(37-32(27)42-5)34-13-10-14-39-17-15-38(3)16-18-39/h11-12,21H,10,13-20H2,1-9H3,(H,35,40)(H,34,36,37) |
| InChIKey | JOPDPEMEDIMFNM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 114.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.97 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|