C6H13N — CID 11788266
(E,3R)-hex-4-en-3-amine (PubChem CID 11788266) has the molecular formula C6H13N and a molecular weight of 99.18 g/mol. Its IUPAC name is (E,3R)-hex-4-en-3-amine.
| Compound Name | (E,3R)-hex-4-en-3-amine |
|---|---|
| PubChem CID | 11788266 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | (E,3R)-hex-4-en-3-amine |
| SMILES | C/C=C/[C@H](N)CC |
| InChI | InChI=1S/C6H13N/c1-3-5-6(7)4-2/h3,5-6H,4,7H2,1-2H3/b5-3+/t6-/m1/s1 |
| InChIKey | BQDADOHFJBDCDD-MXTDHUQFSA-N |
| XLogP | 1.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|