About 3-ethenoxybenzonitrile
3-ethenoxybenzonitrile (PubChem CID 11788364) has the molecular formula C9H7NO
and a molecular weight of 145.16 g/mol. Its IUPAC name is 3-ethenoxybenzonitrile.
Molecular Properties
| Compound Name | 3-ethenoxybenzonitrile |
| PubChem CID | 11788364 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 3-ethenoxybenzonitrile |
| SMILES | C=COc1cccc(C#N)c1 |
| InChI | InChI=1S/C9H7NO/c1-2-11-9-5-3-4-8(6-9)7-10/h2-6H,1H2 |
| InChIKey | HXZPDCUIXJROII-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenoxybenzonitrile?
The IUPAC name of 3-ethenoxybenzonitrile (CID 11788364) is 3-ethenoxybenzonitrile.
What is the SMILES notation for 3-ethenoxybenzonitrile?
The canonical SMILES for 3-ethenoxybenzonitrile is C=COc1cccc(C#N)c1.
What is the InChIKey of 3-ethenoxybenzonitrile?
The InChIKey is HXZPDCUIXJROII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO/c1-2-11-9-5-3-4-8(6-9)7-10/h2-6H,1H2.
What are the key properties of 3-ethenoxybenzonitrile?
3-ethenoxybenzonitrile has a molecular weight of 145.16 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenoxybenzonitrile is sourced from PubChem (CID 11788364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).