C10H6N2O — CID 45091107
4-ethenoxybenzene-1,2-dicarbonitrile (PubChem CID 45091107) has the molecular formula C10H6N2O and a molecular weight of 170.17 g/mol. Its IUPAC name is 4-ethenoxybenzene-1,2-dicarbonitrile.
| Compound Name | 4-ethenoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 45091107 |
| Molecular Formula | C10H6N2O |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 4-ethenoxybenzene-1,2-dicarbonitrile |
| SMILES | C=COc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C10H6N2O/c1-2-13-10-4-3-8(6-11)9(5-10)7-12/h2-5H,1H2 |
| InChIKey | FVSXHOQQAVWFLP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|