C10H15NO3 — CID 11788834
ethyl 5-tert-butyl-1,3-oxazole-2-carboxylate (PubChem CID 11788834) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is ethyl 5-tert-butyl-1,3-oxazole-2-carboxylate.
| Compound Name | ethyl 5-tert-butyl-1,3-oxazole-2-carboxylate |
|---|---|
| PubChem CID | 11788834 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | ethyl 5-tert-butyl-1,3-oxazole-2-carboxylate |
| SMILES | CCOC(=O)c1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C10H15NO3/c1-5-13-9(12)8-11-6-7(14-8)10(2,3)4/h6H,5H2,1-4H3 |
| InChIKey | XJAFBPCIGZMUPR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |