C16H17FNO5P — CID 11792349
(2S)-2-amino-3-[3-(2-fluorophenyl)-5-(phosphonomethyl)phenyl]propanoic acid (PubChem CID 11792349) has the molecular formula C16H17FNO5P and a molecular weight of 353.29 g/mol. Its IUPAC name is (2S)-2-amino-3-[3-(2-fluorophenyl)-5-(phosphonomethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[3-(2-fluorophenyl)-5-(phosphonomethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 11792349 |
| Molecular Formula | C16H17FNO5P |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (2S)-2-amino-3-[3-(2-fluorophenyl)-5-(phosphonomethyl)phenyl]propanoic acid |
| SMILES | N[C@@H](Cc1cc(CP(=O)(O)O)cc(-c2ccccc2F)c1)C(=O)O |
| InChI | InChI=1S/C16H17FNO5P/c17-14-4-2-1-3-13(14)12-6-10(8-15(18)16(19)20)5-11(7-12)9-24(21,22)23/h1-7,15H,8-9,18H2,(H,19,20)(H2,21,22,23)/t15-/m0/s1 |
| InChIKey | SDHBFIKRJZQKLR-HNNXBMFYSA-N |
| XLogP | 2.12 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|