C20H34O6 — CID 11793531
methyl (2Z,4E)-2-[(E)-4,4-diethoxybut-1-enyl]-7,7-diethoxyhepta-2,4-dienoate (PubChem CID 11793531) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is methyl (2Z,4E)-2-[(E)-4,4-diethoxybut-1-enyl]-7,7-diethoxyhepta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-2-[(E)-4,4-diethoxybut-1-enyl]-7,7-diethoxyhepta-2,4-dienoate |
|---|---|
| PubChem CID | 11793531 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | methyl (2Z,4E)-2-[(E)-4,4-diethoxybut-1-enyl]-7,7-diethoxyhepta-2,4-dienoate |
| SMILES | CCOC(C/C=C/C=C(/C=C/CC(OCC)OCC)C(=O)OC)OCC |
| InChI | InChI=1S/C20H34O6/c1-6-23-18(24-7-2)15-11-10-13-17(20(21)22-5)14-12-16-19(25-8-3)26-9-4/h10-14,18-19H,6-9,15-16H2,1-5H3/b11-10+,14-12+,17-13- |
| InChIKey | LPJDXEIZGQLBHN-JCDBRARRSA-N |
| XLogP | 3.78 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|