C24H21NO3 — CID 11793583
methyl (4S,5S)-5-benzyl-2,4-diphenyl-4H-1,3-oxazole-5-carboxylate (PubChem CID 11793583) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl (4S,5S)-5-benzyl-2,4-diphenyl-4H-1,3-oxazole-5-carboxylate.
| Compound Name | methyl (4S,5S)-5-benzyl-2,4-diphenyl-4H-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 11793583 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | methyl (4S,5S)-5-benzyl-2,4-diphenyl-4H-1,3-oxazole-5-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccccc2)OC(c2ccccc2)=N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H21NO3/c1-27-23(26)24(17-18-11-5-2-6-12-18)21(19-13-7-3-8-14-19)25-22(28-24)20-15-9-4-10-16-20/h2-16,21H,17H2,1H3/t21-,24-/m0/s1 |
| InChIKey | VWBQQLCDTMCSRB-URXFXBBRSA-N |
| XLogP | 4.36 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |