C21H27NO3S — CID 11793751
N-hydroxy-3-(4-methoxyphenyl)sulfanyl-3-methyl-7-phenylheptanamide (PubChem CID 11793751) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is N-hydroxy-3-(4-methoxyphenyl)sulfanyl-3-methyl-7-phenylheptanamide.
| Compound Name | N-hydroxy-3-(4-methoxyphenyl)sulfanyl-3-methyl-7-phenylheptanamide |
|---|---|
| PubChem CID | 11793751 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-hydroxy-3-(4-methoxyphenyl)sulfanyl-3-methyl-7-phenylheptanamide |
| SMILES | COc1ccc(SC(C)(CCCCc2ccccc2)CC(=O)NO)cc1 |
| InChI | InChI=1S/C21H27NO3S/c1-21(16-20(23)22-24,26-19-13-11-18(25-2)12-14-19)15-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,11-14,24H,6-7,10,15-16H2,1-2H3,(H,22,23) |
| InChIKey | SMCSLYNRUWIOEH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|