C16H26 — CID 11794
1,2,3,4,5-pentaethylbenzene (PubChem CID 11794) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 1,2,3,4,5-pentaethylbenzene.
| Compound Name | 1,2,3,4,5-pentaethylbenzene |
|---|---|
| PubChem CID | 11794 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1,2,3,4,5-pentaethylbenzene |
| SMILES | CCc1cc(CC)c(CC)c(CC)c1CC |
| InChI | InChI=1S/C16H26/c1-6-12-11-13(7-2)15(9-4)16(10-5)14(12)8-3/h11H,6-10H2,1-5H3 |
| InChIKey | JREJWHNDQOGSQT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |