C19H19N2O2+ — CID 11795652
3-(2-methoxyphenyl)-2,6-dimethyl-1-phenylpyrimidin-1-ium-4-one (PubChem CID 11795652) has the molecular formula C19H19N2O2+ and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-2,6-dimethyl-1-phenylpyrimidin-1-ium-4-one.
| Compound Name | 3-(2-methoxyphenyl)-2,6-dimethyl-1-phenylpyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 11795652 |
| Molecular Formula | C19H19N2O2+ |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 3-(2-methoxyphenyl)-2,6-dimethyl-1-phenylpyrimidin-1-ium-4-one |
| SMILES | COc1ccccc1-n1c(C)[n+](-c2ccccc2)c(C)cc1=O |
| InChI | InChI=1S/C19H19N2O2/c1-14-13-19(22)21(17-11-7-8-12-18(17)23-3)15(2)20(14)16-9-5-4-6-10-16/h4-13H,1-3H3/q+1 |
| InChIKey | KYAMCGAHADIMHD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|