About 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one
3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one (PubChem CID 86043980) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one.
Molecular Properties
| Compound Name | 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one |
| PubChem CID | 86043980 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one |
| SMILES | COc1ccccc1-n1c(C)cn(C)c1=O |
| InChI | InChI=1S/C12H14N2O2/c1-9-8-13(2)12(15)14(9)10-6-4-5-7-11(10)16-3/h4-8H,1-3H3 |
| InChIKey | XCGQWWJGMXNISW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one?
The IUPAC name of 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one (CID 86043980) is 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one.
What is the SMILES notation for 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one?
The canonical SMILES for 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one is COc1ccccc1-n1c(C)cn(C)c1=O.
What is the InChIKey of 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one?
The InChIKey is XCGQWWJGMXNISW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-9-8-13(2)12(15)14(9)10-6-4-5-7-11(10)16-3/h4-8H,1-3H3.
What are the key properties of 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one?
3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one has a molecular weight of 218.26 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxyphenyl)-1,4-dimethylimidazol-2-one is sourced from PubChem (CID 86043980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).