C26H30N4O — CID 11796080
4-[(E)-[(3E)-3-[(4-carbamimidoylphenyl)methylidene]-2-oxocyclodecylidene]methyl]benzenecarboximidamide (PubChem CID 11796080) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is 4-[(E)-[(3E)-3-[(4-carbamimidoylphenyl)methylidene]-2-oxocyclodecylidene]methyl]benzenecarboximidamide.
| Compound Name | 4-[(E)-[(3E)-3-[(4-carbamimidoylphenyl)methylidene]-2-oxocyclodecylidene]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 11796080 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 4-[(E)-[(3E)-3-[(4-carbamimidoylphenyl)methylidene]-2-oxocyclodecylidene]methyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(/C=C2\CCCCCCC/C(=C\c3ccc(/C(N)=N/[H])cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H30N4O/c27-25(28)20-12-8-18(9-13-20)16-22-6-4-2-1-3-5-7-23(24(22)31)17-19-10-14-21(15-11-19)26(29)30/h8-17H,1-7H2,(H3,27,28)(H3,29,30)/b22-16+,23-17+ |
| InChIKey | NTOPOHYVAZXHQE-LKNRODPVSA-N |
| XLogP | 5.04 |
| TPSA | 116.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|