About (4-carbamimidoylphenyl) 2-cyclohexylideneacetate
(4-carbamimidoylphenyl) 2-cyclohexylideneacetate (PubChem CID 19840940) has the molecular formula C15H18N2O2
and a molecular weight of 258.32 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 2-cyclohexylideneacetate.
Molecular Properties
| Compound Name | (4-carbamimidoylphenyl) 2-cyclohexylideneacetate |
| PubChem CID | 19840940 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (4-carbamimidoylphenyl) 2-cyclohexylideneacetate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)C=C2CCCCC2)cc1 |
| InChI | InChI=1S/C15H18N2O2/c16-15(17)12-6-8-13(9-7-12)19-14(18)10-11-4-2-1-3-5-11/h6-10H,1-5H2,(H3,16,17) |
| InChIKey | BTWQACKFEKNTEX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-carbamimidoylphenyl) 2-cyclohexylideneacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamimidoylphenyl) 2-cyclohexylideneacetate?
The IUPAC name of (4-carbamimidoylphenyl) 2-cyclohexylideneacetate (CID 19840940) is (4-carbamimidoylphenyl) 2-cyclohexylideneacetate.
What is the SMILES notation for (4-carbamimidoylphenyl) 2-cyclohexylideneacetate?
The canonical SMILES for (4-carbamimidoylphenyl) 2-cyclohexylideneacetate is [H]/N=C(\N)c1ccc(OC(=O)C=C2CCCCC2)cc1.
What is the InChIKey of (4-carbamimidoylphenyl) 2-cyclohexylideneacetate?
The InChIKey is BTWQACKFEKNTEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2/c16-15(17)12-6-8-13(9-7-12)19-14(18)10-11-4-2-1-3-5-11/h6-10H,1-5H2,(H3,16,17).
What are the key properties of (4-carbamimidoylphenyl) 2-cyclohexylideneacetate?
(4-carbamimidoylphenyl) 2-cyclohexylideneacetate has a molecular weight of 258.32 g/mol, XLogP of 2.77, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamimidoylphenyl) 2-cyclohexylideneacetate is sourced from PubChem (CID 19840940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).