C25H38O5 — CID 11796302
[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-(2,3,5,6-tetramethoxyphenyl)methanol (PubChem CID 11796302) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-(2,3,5,6-tetramethoxyphenyl)methanol.
| Compound Name | [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-(2,3,5,6-tetramethoxyphenyl)methanol |
|---|---|
| PubChem CID | 11796302 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]-(2,3,5,6-tetramethoxyphenyl)methanol |
| SMILES | C=C1CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C(O)c1c(OC)c(OC)cc(OC)c1OC |
| InChI | InChI=1S/C25H38O5/c1-15-10-11-18-24(2,3)12-9-13-25(18,4)20(15)21(26)19-22(29-7)16(27-5)14-17(28-6)23(19)30-8/h14,18,20-21,26H,1,9-13H2,2-8H3/t18-,20+,21?,25-/m0/s1 |
| InChIKey | ZLTRZHFTLIPYFU-BWOOEJRBSA-N |
| XLogP | 5.55 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|