C24H21NO4S — CID 11796339
(1S,8S)-15-(benzenesulfonyl)-3,10-dimethyl-16-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (PubChem CID 11796339) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is (1S,8S)-15-(benzenesulfonyl)-3,10-dimethyl-16-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene.
| Compound Name | (1S,8S)-15-(benzenesulfonyl)-3,10-dimethyl-16-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
|---|---|
| PubChem CID | 11796339 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (1S,8S)-15-(benzenesulfonyl)-3,10-dimethyl-16-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| SMILES | Cc1cccc2c1[C@@H]1c3cccc(C)c3[C@H]2C(S(=O)(=O)c2ccccc2)C1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21NO4S/c1-14-8-7-13-18-19(14)21-17-12-6-9-15(2)20(17)22(18)24(23(21)25(26)27)30(28,29)16-10-4-3-5-11-16/h3-13,21-24H,1-2H3/t21-,22-,23?,24?/m0/s1 |
| InChIKey | GHOIHQGIQSTGQX-WOLZVPSQSA-N |
| XLogP | 4.38 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|