C28H24O2S — CID 134982597
(1R,2R,3R)-1-(4-methylphenyl)sulfonyl-2,3-diphenyl-2,3-dihydro-1H-indene (PubChem CID 134982597) has the molecular formula C28H24O2S and a molecular weight of 424.57 g/mol. Its IUPAC name is (1R,2R,3R)-1-(4-methylphenyl)sulfonyl-2,3-diphenyl-2,3-dihydro-1H-indene.
| Compound Name | (1R,2R,3R)-1-(4-methylphenyl)sulfonyl-2,3-diphenyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 134982597 |
| Molecular Formula | C28H24O2S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (1R,2R,3R)-1-(4-methylphenyl)sulfonyl-2,3-diphenyl-2,3-dihydro-1H-indene |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2c3ccccc3[C@@H](c3ccccc3)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H24O2S/c1-20-16-18-23(19-17-20)31(29,30)28-25-15-9-8-14-24(25)26(21-10-4-2-5-11-21)27(28)22-12-6-3-7-13-22/h2-19,26-28H,1H3/t26-,27+,28+/m1/s1 |
| InChIKey | GMLFPXVOQCOWMV-PKTNWEFCSA-N |
| XLogP | 6.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |