C25H27NO2S — CID 157385773
(4R)-2,2-dimethyl-3-(4-methylphenyl)sulfonyl-4,5-diphenylpyrrolidine (PubChem CID 157385773) has the molecular formula C25H27NO2S and a molecular weight of 405.56 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-3-(4-methylphenyl)sulfonyl-4,5-diphenylpyrrolidine.
| Compound Name | (4R)-2,2-dimethyl-3-(4-methylphenyl)sulfonyl-4,5-diphenylpyrrolidine |
|---|---|
| PubChem CID | 157385773 |
| Molecular Formula | C25H27NO2S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (4R)-2,2-dimethyl-3-(4-methylphenyl)sulfonyl-4,5-diphenylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)C2[C@H](c3ccccc3)C(c3ccccc3)NC2(C)C)cc1 |
| InChI | InChI=1S/C25H27NO2S/c1-18-14-16-21(17-15-18)29(27,28)24-22(19-10-6-4-7-11-19)23(26-25(24,2)3)20-12-8-5-9-13-20/h4-17,22-24,26H,1-3H3/t22-,23?,24?/m1/s1 |
| InChIKey | BLKHBXFVCUJRMN-ZKMFCFPVSA-N |
| XLogP | 5.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |